C15H22N4O2S — CID 122060202
4-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122060202) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122060202 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[(6-thiomorpholin-4-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(Nc2cc(N3CCSCC3)ncn2)CC1 |
| InChI | InChI=1S/C15H22N4O2S/c20-15(21)11-1-3-12(4-2-11)18-13-9-14(17-10-16-13)19-5-7-22-8-6-19/h9-12H,1-8H2,(H,20,21)(H,16,17,18) |
| InChIKey | HYAPXSAZHZJQEF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |