C16H24N4O2 — CID 91827802
methyl 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylate (PubChem CID 91827802) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 91827802 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | methyl 4-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Nc2cc(N3CCCC3)ncn2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-22-16(21)12-4-6-13(7-5-12)19-14-10-15(18-11-17-14)20-8-2-3-9-20/h10-13H,2-9H2,1H3,(H,17,18,19) |
| InChIKey | KPZJHBKIQANQKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |