C14H23N5OS — CID 128844019
N-(1,4-oxazepan-2-ylmethyl)-6-thiomorpholin-4-ylpyrimidin-4-amine (PubChem CID 128844019) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is N-(1,4-oxazepan-2-ylmethyl)-6-thiomorpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-(1,4-oxazepan-2-ylmethyl)-6-thiomorpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 128844019 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(1,4-oxazepan-2-ylmethyl)-6-thiomorpholin-4-ylpyrimidin-4-amine |
| SMILES | c1nc(NCC2CNCCCO2)cc(N2CCSCC2)n1 |
| InChI | InChI=1S/C14H23N5OS/c1-2-15-9-12(20-5-1)10-16-13-8-14(18-11-17-13)19-3-6-21-7-4-19/h8,11-12,15H,1-7,9-10H2,(H,16,17,18) |
| InChIKey | IKIVBTVUHUSKJM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |