C19H29N5O2 — CID 70787883
2-morpholin-2-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone (PubChem CID 70787883) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-morpholin-2-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-morpholin-2-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70787883 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-morpholin-2-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CNCCO1)N1CCC(c2cc(N3CCCC3)ncn2)CC1 |
| InChI | InChI=1S/C19H29N5O2/c25-19(11-16-13-20-5-10-26-16)24-8-3-15(4-9-24)17-12-18(22-14-21-17)23-6-1-2-7-23/h12,14-16,20H,1-11,13H2 |
| InChIKey | PBFJORMFSZYBFH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |