C19H29N5O2 — CID 70708382
2-morpholin-4-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone (PubChem CID 70708382) has the molecular formula C19H29N5O2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-morpholin-4-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70708382 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-morpholin-4-yl-1-[4-(6-pyrrolidin-1-ylpyrimidin-4-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCOCC1)N1CCC(c2cc(N3CCCC3)ncn2)CC1 |
| InChI | InChI=1S/C19H29N5O2/c25-19(14-22-9-11-26-12-10-22)24-7-3-16(4-8-24)17-13-18(21-15-20-17)23-5-1-2-6-23/h13,15-16H,1-12,14H2 |
| InChIKey | IEVDZKPNKYZZGI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |