C12H12N2O3S — CID 24770068
[(2R,4S)-2-(4-nitrophenyl)oxan-4-yl] thiocyanate (PubChem CID 24770068) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is [(2R,4S)-2-(4-nitrophenyl)oxan-4-yl] thiocyanate.
| Compound Name | [(2R,4S)-2-(4-nitrophenyl)oxan-4-yl] thiocyanate |
|---|---|
| PubChem CID | 24770068 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | [(2R,4S)-2-(4-nitrophenyl)oxan-4-yl] thiocyanate |
| SMILES | N#CS[C@H]1CCO[C@@H](c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C12H12N2O3S/c13-8-18-11-5-6-17-12(7-11)9-1-3-10(4-2-9)14(15)16/h1-4,11-12H,5-7H2/t11-,12+/m0/s1 |
| InChIKey | PCBANEGDMBVGSN-NWDGAFQWSA-N |
| XLogP | 3.03 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|