C15H17NO — CID 118052996
[(2S,5S)-5-naphthalen-2-yloxolan-2-yl]methanamine (PubChem CID 118052996) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is [(2S,5S)-5-naphthalen-2-yloxolan-2-yl]methanamine.
| Compound Name | [(2S,5S)-5-naphthalen-2-yloxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 118052996 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(2S,5S)-5-naphthalen-2-yloxolan-2-yl]methanamine |
| SMILES | NC[C@@H]1CC[C@@H](c2ccc3ccccc3c2)O1 |
| InChI | InChI=1S/C15H17NO/c16-10-14-7-8-15(17-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,14-15H,7-8,10,16H2/t14-,15-/m0/s1 |
| InChIKey | BVTKYAZPIRQNNS-GJZGRUSLSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |