C12H14N2O — CID 14935545
2-[(2R,4R)-2-methyl-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile (PubChem CID 14935545) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(2R,4R)-2-methyl-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile.
| Compound Name | 2-[(2R,4R)-2-methyl-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 14935545 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[(2R,4R)-2-methyl-4-phenyl-1,3-oxazolidin-3-yl]acetonitrile |
| SMILES | C[C@H]1OC[C@@H](c2ccccc2)N1CC#N |
| InChI | InChI=1S/C12H14N2O/c1-10-14(8-7-13)12(9-15-10)11-5-3-2-4-6-11/h2-6,10,12H,8-9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | MZUDYVVJYQAUEO-PWSUYJOCSA-N |
| XLogP | 1.93 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|