C12H17NO2 — CID 11241219
(4R,5R)-2,3-dimethyl-4-phenyl-1,3-oxazinan-5-ol (PubChem CID 11241219) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (4R,5R)-2,3-dimethyl-4-phenyl-1,3-oxazinan-5-ol.
| Compound Name | (4R,5R)-2,3-dimethyl-4-phenyl-1,3-oxazinan-5-ol |
|---|---|
| PubChem CID | 11241219 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4R,5R)-2,3-dimethyl-4-phenyl-1,3-oxazinan-5-ol |
| SMILES | CC1OC[C@H](O)[C@@H](c2ccccc2)N1C |
| InChI | InChI=1S/C12H17NO2/c1-9-13(2)12(11(14)8-15-9)10-6-4-3-5-7-10/h3-7,9,11-12,14H,8H2,1-2H3/t9?,11-,12+/m0/s1 |
| InChIKey | CFQRYAURGICDPO-CLGJWYQZSA-N |
| XLogP | 1.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |