C18H21NO3 — CID 11208782
benzyl (2R,4R,5S)-5-ethenyl-4-formyl-1-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 11208782) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is benzyl (2R,4R,5S)-5-ethenyl-4-formyl-1-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | benzyl (2R,4R,5S)-5-ethenyl-4-formyl-1-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11208782 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | benzyl (2R,4R,5S)-5-ethenyl-4-formyl-1-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CCN1[C@@H](C(=O)OCc2ccccc2)C[C@@H](C=O)[C@@H]1C=C |
| InChI | InChI=1S/C18H21NO3/c1-3-10-19-16(4-2)15(12-20)11-17(19)18(21)22-13-14-8-6-5-7-9-14/h3-9,12,15-17H,1-2,10-11,13H2/t15-,16-,17+/m0/s1 |
| InChIKey | NQUYNOJMHJODPJ-YESZJQIVSA-N |
| XLogP | 2.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|