C18H23NO4 — CID 11652623
tert-butyl (4S,5S)-3-benzyl-2-oxo-5-prop-1-en-2-yl-1,3-oxazolidine-4-carboxylate (PubChem CID 11652623) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is tert-butyl (4S,5S)-3-benzyl-2-oxo-5-prop-1-en-2-yl-1,3-oxazolidine-4-carboxylate.
| Compound Name | tert-butyl (4S,5S)-3-benzyl-2-oxo-5-prop-1-en-2-yl-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 11652623 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | tert-butyl (4S,5S)-3-benzyl-2-oxo-5-prop-1-en-2-yl-1,3-oxazolidine-4-carboxylate |
| SMILES | C=C(C)[C@@H]1OC(=O)N(Cc2ccccc2)[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO4/c1-12(2)15-14(16(20)23-18(3,4)5)19(17(21)22-15)11-13-9-7-6-8-10-13/h6-10,14-15H,1,11H2,2-5H3/t14-,15-/m0/s1 |
| InChIKey | YMPYNSFZPDBVNQ-GJZGRUSLSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|