C20H26N2O5 — CID 10785614
tert-butyl (2S)-2-[(4R)-3-benzyl-2,5-dioxo-1,3-oxazolidin-4-yl]piperidine-1-carboxylate (PubChem CID 10785614) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4R)-3-benzyl-2,5-dioxo-1,3-oxazolidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4R)-3-benzyl-2,5-dioxo-1,3-oxazolidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10785614 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl (2S)-2-[(4R)-3-benzyl-2,5-dioxo-1,3-oxazolidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1[C@@H]1C(=O)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O5/c1-20(2,3)27-19(25)21-12-8-7-11-15(21)16-17(23)26-18(24)22(16)13-14-9-5-4-6-10-14/h4-6,9-10,15-16H,7-8,11-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | ZUFDWEOKBRYBAR-JKSUJKDBSA-N |
| XLogP | 3.32 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|