C26H36N2O4 — CID 100561539
(2S)-2-[4-(4-methoxyphenoxy)butanoyl-[(4-methylphenyl)methyl]amino]-N-propylbutanamide (PubChem CID 100561539) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (2S)-2-[4-(4-methoxyphenoxy)butanoyl-[(4-methylphenyl)methyl]amino]-N-propylbutanamide.
| Compound Name | (2S)-2-[4-(4-methoxyphenoxy)butanoyl-[(4-methylphenyl)methyl]amino]-N-propylbutanamide |
|---|---|
| PubChem CID | 100561539 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (2S)-2-[4-(4-methoxyphenoxy)butanoyl-[(4-methylphenyl)methyl]amino]-N-propylbutanamide |
| SMILES | CCCNC(=O)[C@H](CC)N(Cc1ccc(C)cc1)C(=O)CCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-5-17-27-26(30)24(6-2)28(19-21-11-9-20(3)10-12-21)25(29)8-7-18-32-23-15-13-22(31-4)14-16-23/h9-16,24H,5-8,17-19H2,1-4H3,(H,27,30)/t24-/m0/s1 |
| InChIKey | UMTIOIGCHOUCRX-DEOSSOPVSA-N |
| XLogP | 4.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|