C26H35FN2O3 — CID 132714719
N-butyl-2-[(4-fluorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide (PubChem CID 132714719) has the molecular formula C26H35FN2O3 and a molecular weight of 442.58 g/mol. Its IUPAC name is N-butyl-2-[(4-fluorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide.
| Compound Name | N-butyl-2-[(4-fluorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
|---|---|
| PubChem CID | 132714719 |
| Molecular Formula | C26H35FN2O3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-butyl-2-[(4-fluorophenyl)methyl-[4-(4-methylphenoxy)butanoyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C26H35FN2O3/c1-4-6-17-28-26(31)24(5-2)29(19-21-11-13-22(27)14-12-21)25(30)8-7-18-32-23-15-9-20(3)10-16-23/h9-16,24H,4-8,17-19H2,1-3H3,(H,28,31) |
| InChIKey | OKNBPAOUSKBYHA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|