C25H33FN2O3 — CID 132711000
N-butyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide (PubChem CID 132711000) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is N-butyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132711000 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-butyl-2-[[2-(3,5-dimethylphenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(F)cc1)C(=O)COc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H33FN2O3/c1-5-7-12-27-25(30)23(6-2)28(16-20-8-10-21(26)11-9-20)24(29)17-31-22-14-18(3)13-19(4)15-22/h8-11,13-15,23H,5-7,12,16-17H2,1-4H3,(H,27,30) |
| InChIKey | RLLHQAOAPDUPTJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|