C25H38N2O6 — CID 10528045
butyl (2S)-3-(4-methoxyphenyl)-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentanecarbonyl]amino]propanoate (PubChem CID 10528045) has the molecular formula C25H38N2O6 and a molecular weight of 462.59 g/mol. Its IUPAC name is butyl (2S)-3-(4-methoxyphenyl)-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentanecarbonyl]amino]propanoate.
| Compound Name | butyl (2S)-3-(4-methoxyphenyl)-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10528045 |
| Molecular Formula | C25H38N2O6 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | butyl (2S)-3-(4-methoxyphenyl)-2-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentanecarbonyl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C1(NC(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C25H38N2O6/c1-6-7-16-32-21(28)20(17-18-10-12-19(31-5)13-11-18)26-22(29)25(14-8-9-15-25)27-23(30)33-24(2,3)4/h10-13,20H,6-9,14-17H2,1-5H3,(H,26,29)(H,27,30)/t20-/m0/s1 |
| InChIKey | OESRSIJJOHQTTO-FQEVSTJZSA-N |
| XLogP | 3.90 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|