C30H45N3O7S — CID 11801588
butyl (2S)-3-(4-hydroxyphenyl)-2-[[1-[[(2S)-3-methyl-2-(2-morpholin-4-ylacetyl)sulfanylbutanoyl]amino]cyclopentanecarbonyl]amino]propanoate (PubChem CID 11801588) has the molecular formula C30H45N3O7S and a molecular weight of 591.77 g/mol. Its IUPAC name is butyl (2S)-3-(4-hydroxyphenyl)-2-[[1-[[(2S)-3-methyl-2-(2-morpholin-4-ylacetyl)sulfanylbutanoyl]amino]cyclopentanecarbonyl]amino]propanoate.
| Compound Name | butyl (2S)-3-(4-hydroxyphenyl)-2-[[1-[[(2S)-3-methyl-2-(2-morpholin-4-ylacetyl)sulfanylbutanoyl]amino]cyclopentanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 11801588 |
| Molecular Formula | C30H45N3O7S |
| Molecular Weight | 591.77 g/mol |
| Exact Mass | 591.30 |
| IUPAC Name | butyl (2S)-3-(4-hydroxyphenyl)-2-[[1-[[(2S)-3-methyl-2-(2-morpholin-4-ylacetyl)sulfanylbutanoyl]amino]cyclopentanecarbonyl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C1(NC(=O)[C@@H](SC(=O)CN2CCOCC2)C(C)C)CCCC1 |
| InChI | InChI=1S/C30H45N3O7S/c1-4-5-16-40-28(37)24(19-22-8-10-23(34)11-9-22)31-29(38)30(12-6-7-13-30)32-27(36)26(21(2)3)41-25(35)20-33-14-17-39-18-15-33/h8-11,21,24,26,34H,4-7,12-20H2,1-3H3,(H,31,38)(H,32,36)/t24-,26-/m0/s1 |
| InChIKey | POQDFHFNUTVTRE-AHWVRZQESA-N |
| XLogP | 2.81 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|