C29H42N4O7 — CID 59088213
methyl (2R)-2-[[(3S)-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]-2-oxoheptanoyl]amino]-3-phenylpropanoate (PubChem CID 59088213) has the molecular formula C29H42N4O7 and a molecular weight of 558.68 g/mol. Its IUPAC name is methyl (2R)-2-[[(3S)-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]-2-oxoheptanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[[(3S)-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]-2-oxoheptanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59088213 |
| Molecular Formula | C29H42N4O7 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | methyl (2R)-2-[[(3S)-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]-2-oxoheptanoyl]amino]-3-phenylpropanoate |
| SMILES | CCCC[C@H](NC(=O)C1(NC(=O)N2CCOCC2)CCCCC1)C(=O)C(=O)N[C@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C29H42N4O7/c1-3-4-13-22(24(34)25(35)30-23(26(36)39-2)20-21-11-7-5-8-12-21)31-27(37)29(14-9-6-10-15-29)32-28(38)33-16-18-40-19-17-33/h5,7-8,11-12,22-23H,3-4,6,9-10,13-20H2,1-2H3,(H,30,35)(H,31,37)(H,32,38)/t22-,23+/m0/s1 |
| InChIKey | CEYRFOAVEIEEGQ-XZOQPEGZSA-N |
| XLogP | 1.88 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|