C22H38N4O7 — CID 67608027
N-[1-[[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide (PubChem CID 67608027) has the molecular formula C22H38N4O7 and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[1-[[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide.
| Compound Name | N-[1-[[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 67608027 |
| Molecular Formula | C22H38N4O7 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N-[1-[[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
| SMILES | CCC[C@H](NC(=O)C1(NC(=O)N2CCOCC2)CCCCC1)C(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C22H38N4O7/c1-4-8-16(18(27)19(28)23-15-17(31-2)32-3)24-20(29)22(9-6-5-7-10-22)25-21(30)26-11-13-33-14-12-26/h16-17H,4-15H2,1-3H3,(H,23,28)(H,24,29)(H,25,30)/t16-/m0/s1 |
| InChIKey | AQKLRDSTRASBMF-INIZCTEOSA-N |
| XLogP | 0.32 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|