C22H39N3O6 — CID 151213821
N-cyclohexyl-N-[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxoheptan-3-yl]morpholine-4-carboxamide (PubChem CID 151213821) has the molecular formula C22H39N3O6 and a molecular weight of 441.57 g/mol. Its IUPAC name is N-cyclohexyl-N-[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxoheptan-3-yl]morpholine-4-carboxamide.
| Compound Name | N-cyclohexyl-N-[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxoheptan-3-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 151213821 |
| Molecular Formula | C22H39N3O6 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | N-cyclohexyl-N-[(3S)-1-(2,2-dimethoxyethylamino)-1,2-dioxoheptan-3-yl]morpholine-4-carboxamide |
| SMILES | CCCC[C@@H](C(=O)C(=O)NCC(OC)OC)N(C(=O)N1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H39N3O6/c1-4-5-11-18(20(26)21(27)23-16-19(29-2)30-3)25(17-9-7-6-8-10-17)22(28)24-12-14-31-15-13-24/h17-19H,4-16H2,1-3H3,(H,23,27)/t18-/m0/s1 |
| InChIKey | NKVKVHNDLVZLSZ-SFHVURJKSA-N |
| XLogP | 1.94 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|