C23H38N4O5 — CID 57304209
N-[1-[[1-(cyclobutylamino)-1,2-dioxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide (PubChem CID 57304209) has the molecular formula C23H38N4O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[1-[[1-(cyclobutylamino)-1,2-dioxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide.
| Compound Name | N-[1-[[1-(cyclobutylamino)-1,2-dioxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 57304209 |
| Molecular Formula | C23H38N4O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | N-[1-[[1-(cyclobutylamino)-1,2-dioxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
| SMILES | CCCCC(NC(=O)C1(NC(=O)N2CCOCC2)CCCCC1)C(=O)C(=O)NC1CCC1 |
| InChI | InChI=1S/C23H38N4O5/c1-2-3-10-18(19(28)20(29)24-17-8-7-9-17)25-21(30)23(11-5-4-6-12-23)26-22(31)27-13-15-32-16-14-27/h17-18H,2-16H2,1H3,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | OVCDHZQGRYLIQR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|