C23H42N4O5 — CID 87250069
N-[1-[[(2S,3S)-3-(butylamino)-2-hydroxy-1-oxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide (PubChem CID 87250069) has the molecular formula C23H42N4O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[1-[[(2S,3S)-3-(butylamino)-2-hydroxy-1-oxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide.
| Compound Name | N-[1-[[(2S,3S)-3-(butylamino)-2-hydroxy-1-oxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 87250069 |
| Molecular Formula | C23H42N4O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | N-[1-[[(2S,3S)-3-(butylamino)-2-hydroxy-1-oxoheptan-3-yl]carbamoyl]cyclohexyl]morpholine-4-carboxamide |
| SMILES | CCCCN[C@@](CCCC)(NC(=O)C1(NC(=O)N2CCOCC2)CCCCC1)[C@H](O)C=O |
| InChI | InChI=1S/C23H42N4O5/c1-3-5-12-23(19(29)18-28,24-13-6-4-2)25-20(30)22(10-8-7-9-11-22)26-21(31)27-14-16-32-17-15-27/h18-19,24,29H,3-17H2,1-2H3,(H,25,30)(H,26,31)/t19-,23+/m1/s1 |
| InChIKey | QZFLSKKIINYYKD-XXBNENTESA-N |
| XLogP | 1.68 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|