C18H31N3O6 — CID 67600452
(3S)-2-hydroxy-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]hexanoic acid (PubChem CID 67600452) has the molecular formula C18H31N3O6 and a molecular weight of 385.46 g/mol. Its IUPAC name is (3S)-2-hydroxy-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]hexanoic acid.
| Compound Name | (3S)-2-hydroxy-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 67600452 |
| Molecular Formula | C18H31N3O6 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (3S)-2-hydroxy-3-[[1-(morpholine-4-carbonylamino)cyclohexanecarbonyl]amino]hexanoic acid |
| SMILES | CCC[C@H](NC(=O)C1(NC(=O)N2CCOCC2)CCCCC1)C(O)C(=O)O |
| InChI | InChI=1S/C18H31N3O6/c1-2-6-13(14(22)15(23)24)19-16(25)18(7-4-3-5-8-18)20-17(26)21-9-11-27-12-10-21/h13-14,22H,2-12H2,1H3,(H,19,25)(H,20,26)(H,23,24)/t13-,14?/m0/s1 |
| InChIKey | VDBFYIRGCBXQPF-LSLKUGRBSA-N |
| XLogP | 0.46 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |