C13H17FO4S — CID 166235869
methyl 3-[(2-fluoro-5-methylphenyl)methylsulfonyl]-2-methylpropanoate (PubChem CID 166235869) has the molecular formula C13H17FO4S and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl 3-[(2-fluoro-5-methylphenyl)methylsulfonyl]-2-methylpropanoate.
| Compound Name | methyl 3-[(2-fluoro-5-methylphenyl)methylsulfonyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 166235869 |
| Molecular Formula | C13H17FO4S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 3-[(2-fluoro-5-methylphenyl)methylsulfonyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CS(=O)(=O)Cc1cc(C)ccc1F |
| InChI | InChI=1S/C13H17FO4S/c1-9-4-5-12(14)11(6-9)8-19(16,17)7-10(2)13(15)18-3/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | MQYSMNIBCMZQMK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |