C14H18Br2O — CID 82758277
2-bromo-1-(2-bromo-5-methylphenyl)-4,4-dimethylpentan-3-one (PubChem CID 82758277) has the molecular formula C14H18Br2O and a molecular weight of 362.11 g/mol. Its IUPAC name is 2-bromo-1-(2-bromo-5-methylphenyl)-4,4-dimethylpentan-3-one.
| Compound Name | 2-bromo-1-(2-bromo-5-methylphenyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 82758277 |
| Molecular Formula | C14H18Br2O |
| Molecular Weight | 362.11 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 2-bromo-1-(2-bromo-5-methylphenyl)-4,4-dimethylpentan-3-one |
| SMILES | Cc1ccc(Br)c(CC(Br)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H18Br2O/c1-9-5-6-11(15)10(7-9)8-12(16)13(17)14(2,3)4/h5-7,12H,8H2,1-4H3 |
| InChIKey | XJJFQEHLBRNLNS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.11 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|