C15H21NO7 — CID 11099473
(2R,4S)-2-amino-4-[(3,4,5-trimethoxyphenyl)methyl]pentanedioic acid (PubChem CID 11099473) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (2R,4S)-2-amino-4-[(3,4,5-trimethoxyphenyl)methyl]pentanedioic acid.
| Compound Name | (2R,4S)-2-amino-4-[(3,4,5-trimethoxyphenyl)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 11099473 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (2R,4S)-2-amino-4-[(3,4,5-trimethoxyphenyl)methyl]pentanedioic acid |
| SMILES | COc1cc(CC(C[C@@H](N)C(=O)O)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H21NO7/c1-21-11-5-8(6-12(22-2)13(11)23-3)4-9(14(17)18)7-10(16)15(19)20/h5-6,9-10H,4,7,16H2,1-3H3,(H,17,18)(H,19,20)/t9?,10-/m1/s1 |
| InChIKey | GVQFSKLQFIGHBO-QVDQXJPCSA-N |
| XLogP | 0.76 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |