C30H27NO8 — CID 158639636
(4-hydroxy-3-methoxy-5-nitrophenyl)-(4-methylphenyl)methanone;(4-hydroxy-3-methoxyphenyl)-(4-methylphenyl)methanone (PubChem CID 158639636) has the molecular formula C30H27NO8 and a molecular weight of 529.55 g/mol. Its IUPAC name is (4-hydroxy-3-methoxy-5-nitrophenyl)-(4-methylphenyl)methanone;(4-hydroxy-3-methoxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | (4-hydroxy-3-methoxy-5-nitrophenyl)-(4-methylphenyl)methanone;(4-hydroxy-3-methoxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 158639636 |
| Molecular Formula | C30H27NO8 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | (4-hydroxy-3-methoxy-5-nitrophenyl)-(4-methylphenyl)methanone;(4-hydroxy-3-methoxyphenyl)-(4-methylphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccc(C)cc2)cc([N+](=O)[O-])c1O.COc1cc(C(=O)c2ccc(C)cc2)ccc1O |
| InChI | InChI=1S/C15H13NO5.C15H14O3/c1-9-3-5-10(6-4-9)14(17)11-7-12(16(19)20)15(18)13(8-11)21-2;1-10-3-5-11(6-4-10)15(17)12-7-8-13(16)14(9-12)18-2/h3-8,18H,1-2H3;3-9,16H,1-2H3 |
| InChIKey | IAFFEBBKTKIAOW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|