C23H26NNa2O9P — CID 163303559
disodium;[2-hydroxy-5-(4-methylbenzoyl)-3-nitrophenyl] 2,2,4-trimethyl-4-phosphonatohexanoate (PubChem CID 163303559) has the molecular formula C23H26NNa2O9P and a molecular weight of 537.41 g/mol. Its IUPAC name is disodium;[2-hydroxy-5-(4-methylbenzoyl)-3-nitrophenyl] 2,2,4-trimethyl-4-phosphonatohexanoate.
| Compound Name | disodium;[2-hydroxy-5-(4-methylbenzoyl)-3-nitrophenyl] 2,2,4-trimethyl-4-phosphonatohexanoate |
|---|---|
| PubChem CID | 163303559 |
| Molecular Formula | C23H26NNa2O9P |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | disodium;[2-hydroxy-5-(4-methylbenzoyl)-3-nitrophenyl] 2,2,4-trimethyl-4-phosphonatohexanoate |
| SMILES | CCC(C)(CC(C)(C)C(=O)Oc1cc(C(=O)c2ccc(C)cc2)cc([N+](=O)[O-])c1O)P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C23H28NO9P.2Na/c1-6-23(5,34(30,31)32)13-22(3,4)21(27)33-18-12-16(11-17(20(18)26)24(28)29)19(25)15-9-7-14(2)8-10-15;;/h7-12,26H,6,13H2,1-5H3,(H2,30,31,32);;/q;2*+1/p-2 |
| InChIKey | VZVBZMZLEUHQPL-UHFFFAOYSA-L |
| XLogP | -2.75 |
| TPSA | 169.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|