C11H7F7N2O3 — CID 58911744
4-fluoro-3-nitro-N,N-bis(2,2,2-trifluoroethyl)benzamide (PubChem CID 58911744) has the molecular formula C11H7F7N2O3 and a molecular weight of 348.17 g/mol. Its IUPAC name is 4-fluoro-3-nitro-N,N-bis(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-fluoro-3-nitro-N,N-bis(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 58911744 |
| Molecular Formula | C11H7F7N2O3 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-fluoro-3-nitro-N,N-bis(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(c1ccc(F)c([N+](=O)[O-])c1)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C11H7F7N2O3/c12-7-2-1-6(3-8(7)20(22)23)9(21)19(4-10(13,14)15)5-11(16,17)18/h1-3H,4-5H2 |
| InChIKey | ABUBCIQFGIBKHX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|