C13H17N3O5 — CID 158639436
2,3-dihydro-1H-pyrazole;1-formamido-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 158639436) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrazole;1-formamido-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 2,3-dihydro-1H-pyrazole;1-formamido-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 158639436 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2,3-dihydro-1H-pyrazole;1-formamido-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C1=CNNC1.CC1C(C(=O)O)=CC=CC1(NC=O)C(=O)O |
| InChI | InChI=1S/C10H11NO5.C3H6N2/c1-6-7(8(13)14)3-2-4-10(6,9(15)16)11-5-12;1-2-4-5-3-1/h2-6H,1H3,(H,11,12)(H,13,14)(H,15,16);1-2,4-5H,3H2 |
| InChIKey | IAEMKOKEPUJZNN-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|