C22H42Si2 — CID 174956431
benzene;bis(1,1,2-trimethylsilinane) (PubChem CID 174956431) has the molecular formula C22H42Si2 and a molecular weight of 362.75 g/mol. Its IUPAC name is benzene;bis(1,1,2-trimethylsilinane).
| Compound Name | benzene;bis(1,1,2-trimethylsilinane) |
|---|---|
| PubChem CID | 174956431 |
| Molecular Formula | C22H42Si2 |
| Molecular Weight | 362.75 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | benzene;bis(1,1,2-trimethylsilinane) |
| SMILES | CC1CCCC[Si]1(C)C.CC1CCCC[Si]1(C)C.c1ccccc1 |
| InChI | InChI=1S/2C8H18Si.C6H6/c2*1-8-6-4-5-7-9(8,2)3;1-2-4-6-5-3-1/h2*8H,4-7H2,1-3H3;1-6H |
| InChIKey | DAFPVZQLNZBXIZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|