C19H33NSi — CID 174570050
1-phenylpiperidine;1,1,2-trimethylsilinane (PubChem CID 174570050) has the molecular formula C19H33NSi and a molecular weight of 303.57 g/mol. Its IUPAC name is 1-phenylpiperidine;1,1,2-trimethylsilinane.
| Compound Name | 1-phenylpiperidine;1,1,2-trimethylsilinane |
|---|---|
| PubChem CID | 174570050 |
| Molecular Formula | C19H33NSi |
| Molecular Weight | 303.57 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 1-phenylpiperidine;1,1,2-trimethylsilinane |
| SMILES | CC1CCCC[Si]1(C)C.c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C8H18Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-8-6-4-5-7-9(8,2)3/h1,3-4,7-8H,2,5-6,9-10H2;8H,4-7H2,1-3H3 |
| InChIKey | KZBRXVZSLJMYFK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|