About 4-cyclohexyl-1-phenylpiperidine;isocyanomethane
4-cyclohexyl-1-phenylpiperidine;isocyanomethane (PubChem CID 91145666) has the molecular formula C19H28N2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-cyclohexyl-1-phenylpiperidine;isocyanomethane.
Molecular Properties
| Compound Name | 4-cyclohexyl-1-phenylpiperidine;isocyanomethane |
| PubChem CID | 91145666 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 4-cyclohexyl-1-phenylpiperidine;isocyanomethane |
| SMILES | [C-]#[N+]C.c1ccc(N2CCC(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C17H25N.C2H3N/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)17-9-5-2-6-10-17;1-3-2/h2,5-6,9-10,15-16H,1,3-4,7-8,11-14H2;1H3 |
| InChIKey | BZXGPVZZFJFVHK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 7.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-1-phenylpiperidine;isocyanomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1-phenylpiperidine;isocyanomethane?
The IUPAC name of 4-cyclohexyl-1-phenylpiperidine;isocyanomethane (CID 91145666) is 4-cyclohexyl-1-phenylpiperidine;isocyanomethane.
What is the SMILES notation for 4-cyclohexyl-1-phenylpiperidine;isocyanomethane?
The canonical SMILES for 4-cyclohexyl-1-phenylpiperidine;isocyanomethane is [C-]#[N+]C.c1ccc(N2CCC(C3CCCCC3)CC2)cc1.
What is the InChIKey of 4-cyclohexyl-1-phenylpiperidine;isocyanomethane?
The InChIKey is BZXGPVZZFJFVHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N.C2H3N/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)17-9-5-2-6-10-17;1-3-2/h2,5-6,9-10,15-16H,1,3-4,7-8,11-14H2;1H3.
What are the key properties of 4-cyclohexyl-1-phenylpiperidine;isocyanomethane?
4-cyclohexyl-1-phenylpiperidine;isocyanomethane has a molecular weight of 284.45 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1-phenylpiperidine;isocyanomethane is sourced from PubChem (CID 91145666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).