C13H27NOSi — CID 174520229
N-prop-2-enylacetamide;1,1,2-trimethylsilinane (PubChem CID 174520229) has the molecular formula C13H27NOSi and a molecular weight of 241.45 g/mol. Its IUPAC name is N-prop-2-enylacetamide;1,1,2-trimethylsilinane.
| Compound Name | N-prop-2-enylacetamide;1,1,2-trimethylsilinane |
|---|---|
| PubChem CID | 174520229 |
| Molecular Formula | C13H27NOSi |
| Molecular Weight | 241.45 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | N-prop-2-enylacetamide;1,1,2-trimethylsilinane |
| SMILES | C=CCNC(C)=O.CC1CCCC[Si]1(C)C |
| InChI | InChI=1S/C8H18Si.C5H9NO/c1-8-6-4-5-7-9(8,2)3;1-3-4-6-5(2)7/h8H,4-7H2,1-3H3;3H,1,4H2,2H3,(H,6,7) |
| InChIKey | QTMLDFVNZYYEBL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|