C23H22N2O4 — CID 29491093
2-benzhydryloxyethyl 4-(carbamoylamino)benzoate (PubChem CID 29491093) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-benzhydryloxyethyl 4-(carbamoylamino)benzoate.
| Compound Name | 2-benzhydryloxyethyl 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 29491093 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-benzhydryloxyethyl 4-(carbamoylamino)benzoate |
| SMILES | NC(=O)Nc1ccc(C(=O)OCCOC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c24-23(27)25-20-13-11-19(12-14-20)22(26)29-16-15-28-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H3,24,25,27) |
| InChIKey | VSLALXWOFWXFHD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|