About 2-benzhydryloxyethyl 4-methylsulfonylbenzoate
2-benzhydryloxyethyl 4-methylsulfonylbenzoate (PubChem CID 31523676) has the molecular formula C23H22O5S
and a molecular weight of 410.49 g/mol. Its IUPAC name is 2-benzhydryloxyethyl 4-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | 2-benzhydryloxyethyl 4-methylsulfonylbenzoate |
| PubChem CID | 31523676 |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-benzhydryloxyethyl 4-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCCOC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22O5S/c1-29(25,26)21-14-12-20(13-15-21)23(24)28-17-16-27-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22H,16-17H2,1H3 |
| InChIKey | YTYFFFFAQDHCAI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-benzhydryloxyethyl 4-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryloxyethyl 4-methylsulfonylbenzoate?
The IUPAC name of 2-benzhydryloxyethyl 4-methylsulfonylbenzoate (CID 31523676) is 2-benzhydryloxyethyl 4-methylsulfonylbenzoate.
What is the SMILES notation for 2-benzhydryloxyethyl 4-methylsulfonylbenzoate?
The canonical SMILES for 2-benzhydryloxyethyl 4-methylsulfonylbenzoate is CS(=O)(=O)c1ccc(C(=O)OCCOC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-benzhydryloxyethyl 4-methylsulfonylbenzoate?
The InChIKey is YTYFFFFAQDHCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O5S/c1-29(25,26)21-14-12-20(13-15-21)23(24)28-17-16-27-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22H,16-17H2,1H3.
What are the key properties of 2-benzhydryloxyethyl 4-methylsulfonylbenzoate?
2-benzhydryloxyethyl 4-methylsulfonylbenzoate has a molecular weight of 410.49 g/mol, XLogP of 4.05, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryloxyethyl 4-methylsulfonylbenzoate is sourced from PubChem (CID 31523676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).