C23H22N2O4S2 — CID 112797376
ethyl 2-[[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate (PubChem CID 112797376) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 2-[[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 112797376 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | ethyl 2-[[3-[(2-oxopyrrolidin-1-yl)methyl]benzoyl]amino]-4-thiophen-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccs2)csc1NC(=O)c1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C23H22N2O4S2/c1-2-29-23(28)20-17(18-8-5-11-30-18)14-31-22(20)24-21(27)16-7-3-6-15(12-16)13-25-10-4-9-19(25)26/h3,5-8,11-12,14H,2,4,9-10,13H2,1H3,(H,24,27) |
| InChIKey | NJKVNVNNSUEAPH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|