C19H19N3O5S — CID 7791916
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate (PubChem CID 7791916) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7791916 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(cyclopropanecarbonylamino)-4-phenylthiophene-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1c(-c2ccccc2)csc1NC(=O)C1CC1)C(=O)NC(N)=O |
| InChI | InChI=1S/C19H19N3O5S/c1-10(15(23)22-19(20)26)27-18(25)14-13(11-5-3-2-4-6-11)9-28-17(14)21-16(24)12-7-8-12/h2-6,9-10,12H,7-8H2,1H3,(H,21,24)(H3,20,22,23,26)/t10-/m1/s1 |
| InChIKey | HDBLNPZSQNMUGZ-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|