C19H13Cl2NO4S — CID 59536083
4-(4-chlorophenyl)-2-[(2-chlorophenyl)methoxycarbonylamino]thiophene-3-carboxylic acid (PubChem CID 59536083) has the molecular formula C19H13Cl2NO4S and a molecular weight of 422.29 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methoxycarbonylamino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methoxycarbonylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59536083 |
| Molecular Formula | C19H13Cl2NO4S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(2-chlorophenyl)methoxycarbonylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)OCc1ccccc1Cl |
| InChI | InChI=1S/C19H13Cl2NO4S/c20-13-7-5-11(6-8-13)14-10-27-17(16(14)18(23)24)22-19(25)26-9-12-3-1-2-4-15(12)21/h1-8,10H,9H2,(H,22,25)(H,23,24) |
| InChIKey | QXQFETNJAKQKAJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |