C20H12Cl2F3NO3S — CID 67224639
2-[[3-(2-chloro-4,5-difluorophenyl)-2-fluoropropanoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid (PubChem CID 67224639) has the molecular formula C20H12Cl2F3NO3S and a molecular weight of 474.29 g/mol. Its IUPAC name is 2-[[3-(2-chloro-4,5-difluorophenyl)-2-fluoropropanoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[[3-(2-chloro-4,5-difluorophenyl)-2-fluoropropanoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67224639 |
| Molecular Formula | C20H12Cl2F3NO3S |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | 2-[[3-(2-chloro-4,5-difluorophenyl)-2-fluoropropanoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)C(F)Cc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C20H12Cl2F3NO3S/c21-11-3-1-9(2-4-11)12-8-30-19(17(12)20(28)29)26-18(27)16(25)6-10-5-14(23)15(24)7-13(10)22/h1-5,7-8,16H,6H2,(H,26,27)(H,28,29) |
| InChIKey | YCMIFYDXZVRPMP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|