C20H13BrCl2FNO3S — CID 58295377
4-(4-bromophenyl)-2-[[3-(2,6-dichlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid (PubChem CID 58295377) has the molecular formula C20H13BrCl2FNO3S and a molecular weight of 517.20 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[[3-(2,6-dichlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-2-[[3-(2,6-dichlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295377 |
| Molecular Formula | C20H13BrCl2FNO3S |
| Molecular Weight | 517.20 g/mol |
| Exact Mass | 514.92 |
| IUPAC Name | 4-(4-bromophenyl)-2-[[3-(2,6-dichlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(F)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H13BrCl2FNO3S/c21-11-6-4-10(5-7-11)13-9-29-19(17(13)20(27)28)25-18(26)16(24)8-12-14(22)2-1-3-15(12)23/h1-7,9,16H,8H2,(H,25,26)(H,27,28) |
| InChIKey | HYFZMFHGFSUZDY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.20 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|