C22H20BrNO3S — CID 59536006
4-(4-bromophenyl)-2-[(2-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid (PubChem CID 59536006) has the molecular formula C22H20BrNO3S and a molecular weight of 458.38 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(2-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-2-[(2-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59536006 |
| Molecular Formula | C22H20BrNO3S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(2-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid |
| SMILES | CC(C(=O)Nc1scc(-c2ccc(Br)cc2)c1C(=O)O)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H20BrNO3S/c1-13(15-6-4-3-5-7-15)14(2)20(25)24-21-19(22(26)27)18(12-28-21)16-8-10-17(23)11-9-16/h3-14H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | APXWXALAZDVJJH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|