C20H17ClN2O3S — CID 67224626
4-(4-chlorophenyl)-2-(2-phenylethylcarbamoylamino)thiophene-3-carboxylic acid (PubChem CID 67224626) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-phenylethylcarbamoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-(2-phenylethylcarbamoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67224626 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-phenylethylcarbamoylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(NCCc1ccccc1)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C20H17ClN2O3S/c21-15-8-6-14(7-9-15)16-12-27-18(17(16)19(24)25)23-20(26)22-11-10-13-4-2-1-3-5-13/h1-9,12H,10-11H2,(H,24,25)(H2,22,23,26) |
| InChIKey | UCDNRYKTLSFPDU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |