C20H16ClN3O3S — CID 58417695
2-[[(Z)-2-amino-3-(2-aminophenyl)prop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid (PubChem CID 58417695) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 2-[[(Z)-2-amino-3-(2-aminophenyl)prop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[[(Z)-2-amino-3-(2-aminophenyl)prop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58417695 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-[[(Z)-2-amino-3-(2-aminophenyl)prop-2-enoyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
| SMILES | N/C(=C\c1ccccc1N)C(=O)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C20H16ClN3O3S/c21-13-7-5-11(6-8-13)14-10-28-19(17(14)20(26)27)24-18(25)16(23)9-12-3-1-2-4-15(12)22/h1-10H,22-23H2,(H,24,25)(H,26,27)/b16-9- |
| InChIKey | OZVHQMAIIMEDEN-SXGWCWSVSA-N |
| XLogP | 4.29 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|