C21H15ClN2O4S — CID 89458037
4-(4-chlorophenyl)-2-[[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]amino]thiophene-3-carboxylic acid (PubChem CID 89458037) has the molecular formula C21H15ClN2O4S and a molecular weight of 426.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458037 |
| Molecular Formula | C21H15ClN2O4S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[2-(2,3-dihydroindol-1-yl)-2-oxoacetyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H15ClN2O4S/c22-14-7-5-12(6-8-14)15-11-29-19(17(15)21(27)28)23-18(25)20(26)24-10-9-13-3-1-2-4-16(13)24/h1-8,11H,9-10H2,(H,23,25)(H,27,28) |
| InChIKey | IEQSNOOFZBUXJG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|