C15H13ClN2O4S — CID 17378866
4-[[3-carbamoyl-4-(4-chlorophenyl)thiophen-2-yl]amino]-4-oxobutanoic acid (PubChem CID 17378866) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is 4-[[3-carbamoyl-4-(4-chlorophenyl)thiophen-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-carbamoyl-4-(4-chlorophenyl)thiophen-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 17378866 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 4-[[3-carbamoyl-4-(4-chlorophenyl)thiophen-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H13ClN2O4S/c16-9-3-1-8(2-4-9)10-7-23-15(13(10)14(17)22)18-11(19)5-6-12(20)21/h1-4,7H,5-6H2,(H2,17,22)(H,18,19)(H,20,21) |
| InChIKey | SPUNEJKSGVKYSU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |