C14H21N3O4 — CID 115950484
2-amino-N-[2-(dimethylamino)-2-oxoethyl]-3,5-dimethoxy-N-methylbenzamide (PubChem CID 115950484) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-3,5-dimethoxy-N-methylbenzamide.
| Compound Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-3,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 115950484 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-amino-N-[2-(dimethylamino)-2-oxoethyl]-3,5-dimethoxy-N-methylbenzamide |
| SMILES | COc1cc(OC)c(N)c(C(=O)N(C)CC(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H21N3O4/c1-16(2)12(18)8-17(3)14(19)10-6-9(20-4)7-11(21-5)13(10)15/h6-7H,8,15H2,1-5H3 |
| InChIKey | IZCJIFSNTCRARX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|