C17H26N2O3 — CID 82071286
3-(5-amino-2,3-dimethoxyphenyl)-1-(azepan-1-yl)propan-1-one (PubChem CID 82071286) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-(5-amino-2,3-dimethoxyphenyl)-1-(azepan-1-yl)propan-1-one.
| Compound Name | 3-(5-amino-2,3-dimethoxyphenyl)-1-(azepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82071286 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 3-(5-amino-2,3-dimethoxyphenyl)-1-(azepan-1-yl)propan-1-one |
| SMILES | COc1cc(N)cc(CCC(=O)N2CCCCCC2)c1OC |
| InChI | InChI=1S/C17H26N2O3/c1-21-15-12-14(18)11-13(17(15)22-2)7-8-16(20)19-9-5-3-4-6-10-19/h11-12H,3-10,18H2,1-2H3 |
| InChIKey | MCDGMDZWIQMHDY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|