C18H27NO4 — CID 156745734
3-(2,5-dihydroxy-3-methoxy-4-propylphenyl)-1-piperidin-1-ylpropan-1-one (PubChem CID 156745734) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3-methoxy-4-propylphenyl)-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-(2,5-dihydroxy-3-methoxy-4-propylphenyl)-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 156745734 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-(2,5-dihydroxy-3-methoxy-4-propylphenyl)-1-piperidin-1-ylpropan-1-one |
| SMILES | CCCc1c(O)cc(CCC(=O)N2CCCCC2)c(O)c1OC |
| InChI | InChI=1S/C18H27NO4/c1-3-7-14-15(20)12-13(17(22)18(14)23-2)8-9-16(21)19-10-5-4-6-11-19/h12,20,22H,3-11H2,1-2H3 |
| InChIKey | AHKUABNJKUZCEF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|