C16H17NO6 — CID 5454853
[(Z)-1-(furan-2-yl)ethylideneamino] 3,4,5-trimethoxybenzoate (PubChem CID 5454853) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is [(Z)-1-(furan-2-yl)ethylideneamino] 3,4,5-trimethoxybenzoate.
| Compound Name | [(Z)-1-(furan-2-yl)ethylideneamino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 5454853 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [(Z)-1-(furan-2-yl)ethylideneamino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O/N=C(/C)c2ccco2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO6/c1-10(12-6-5-7-22-12)17-23-16(18)11-8-13(19-2)15(21-4)14(9-11)20-3/h5-9H,1-4H3/b17-10- |
| InChIKey | FAQPERCZQOQCQS-YVLHZVERSA-N |
| XLogP | 2.89 |
| TPSA | 79.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|